C27H30Cl2INOS — CID 70644580
(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-ethylsulfanylethyl]-3-iodo-3-prop-2-enylpiperidin-2-one (PubChem CID 70644580) has the molecular formula C27H30Cl2INOS and a molecular weight of 614.42 g/mol. Its IUPAC name is (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-ethylsulfanylethyl]-3-iodo-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-ethylsulfanylethyl]-3-iodo-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 70644580 |
| Molecular Formula | C27H30Cl2INOS |
| Molecular Weight | 614.42 g/mol |
| Exact Mass | 613.05 |
| IUPAC Name | (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-ethylsulfanylethyl]-3-iodo-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(I)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](CSCC)C2CC2)C1=O |
| InChI | InChI=1S/C27H30Cl2INOS/c1-3-14-27(30)16-23(20-6-5-7-22(29)15-20)25(19-10-12-21(28)13-11-19)31(26(27)32)24(17-33-4-2)18-8-9-18/h3,5-7,10-13,15,18,23-25H,1,4,8-9,14,16-17H2,2H3/t23-,24-,25-,27-/m1/s1 |
| InChIKey | SAUVIMMUCHZHHM-DLGLWYJGSA-N |
| XLogP | 8.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.42 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|