C26H27Cl2NO2 — CID 154430540
(2S)-2-[(6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]-2-cyclopropylacetaldehyde (PubChem CID 154430540) has the molecular formula C26H27Cl2NO2 and a molecular weight of 456.41 g/mol. Its IUPAC name is (2S)-2-[(6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]-2-cyclopropylacetaldehyde.
| Compound Name | (2S)-2-[(6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]-2-cyclopropylacetaldehyde |
|---|---|
| PubChem CID | 154430540 |
| Molecular Formula | C26H27Cl2NO2 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (2S)-2-[(6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]-2-cyclopropylacetaldehyde |
| SMILES | C=CCC1(C)CC(c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](C=O)C2CC2)C1=O |
| InChI | InChI=1S/C26H27Cl2NO2/c1-3-13-26(2)15-22(19-5-4-6-21(28)14-19)24(18-9-11-20(27)12-10-18)29(25(26)31)23(16-30)17-7-8-17/h3-6,9-12,14,16-17,22-24H,1,7-8,13,15H2,2H3/t22?,23-,24-,26?/m1/s1 |
| InChIKey | GGFIFKULVJMRCW-XHGWCDTISA-N |
| XLogP | 6.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|