C30H30Cl2N2O — CID 67998514
(5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 67998514) has the molecular formula C30H30Cl2N2O and a molecular weight of 505.49 g/mol. Its IUPAC name is (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 67998514 |
| Molecular Formula | C30H30Cl2N2O |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(c2ccccn2)C2CC2)C1=O |
| InChI | InChI=1S/C30H30Cl2N2O/c1-3-16-30(2)19-25(22-7-6-8-24(32)18-22)27(20-12-14-23(31)15-13-20)34(29(30)35)28(21-10-11-21)26-9-4-5-17-33-26/h3-9,12-15,17-18,21,25,27-28H,1,10-11,16,19H2,2H3/t25-,27-,28?,30?/m1/s1 |
| InChIKey | HASHDNIEGYVUBC-FZYUDLCZSA-N |
| XLogP | 8.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|