C24H27ClN2O — CID 167215651
6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 167215651) has the molecular formula C24H27ClN2O and a molecular weight of 394.95 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | 6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 167215651 |
| Molecular Formula | C24H27ClN2O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 6-(4-chlorophenyl)-1-[cyclopropyl(pyridin-2-yl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)CCC(c2ccc(Cl)cc2)N(C(c2ccccn2)C2CC2)C1=O |
| InChI | InChI=1S/C24H27ClN2O/c1-3-14-24(2)15-13-21(17-9-11-19(25)12-10-17)27(23(24)28)22(18-7-8-18)20-6-4-5-16-26-20/h3-6,9-12,16,18,21-22H,1,7-8,13-15H2,2H3 |
| InChIKey | CAFWRLHVBGNBOF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|