C22H32Cl2N2O3S — CID 138642370
3-chloro-N-[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]propane-1-sulfonamide (PubChem CID 138642370) has the molecular formula C22H32Cl2N2O3S and a molecular weight of 475.48 g/mol. Its IUPAC name is 3-chloro-N-[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 138642370 |
| Molecular Formula | C22H32Cl2N2O3S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-chloro-N-[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]propane-1-sulfonamide |
| SMILES | C=CC[C@@]1(C)CCC(c2ccc(Cl)cc2)N(C(CC)CNS(=O)(=O)CCCCl)C1=O |
| InChI | InChI=1S/C22H32Cl2N2O3S/c1-4-12-22(3)13-11-20(17-7-9-18(24)10-8-17)26(21(22)27)19(5-2)16-25-30(28,29)15-6-14-23/h4,7-10,19-20,25H,1,5-6,11-16H2,2-3H3/t19?,20?,22-/m0/s1 |
| InChIKey | ZKDWQXKZLRVPCT-AOMIVXANSA-N |
| XLogP | 4.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|