C20H26ClNO4 — CID 138641755
2-[6-(4-chlorophenyl)-3-methyl-2-oxo-1-(4-oxohexan-3-yl)piperidin-3-yl]acetic acid (PubChem CID 138641755) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-3-methyl-2-oxo-1-(4-oxohexan-3-yl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[6-(4-chlorophenyl)-3-methyl-2-oxo-1-(4-oxohexan-3-yl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 138641755 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-3-methyl-2-oxo-1-(4-oxohexan-3-yl)piperidin-3-yl]acetic acid |
| SMILES | CCC(=O)C(CC)N1C(=O)C(C)(CC(=O)O)CCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO4/c1-4-15(17(23)5-2)22-16(13-6-8-14(21)9-7-13)10-11-20(3,19(22)26)12-18(24)25/h6-9,15-16H,4-5,10-12H2,1-3H3,(H,24,25) |
| InChIKey | ITKWQPLTJOGGNX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |