C20H29ClN4O3 — CID 138641654
[[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetyl]amino]urea (PubChem CID 138641654) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is [[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetyl]amino]urea.
| Compound Name | [[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetyl]amino]urea |
|---|---|
| PubChem CID | 138641654 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [[2-[(3R)-6-(4-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]acetyl]amino]urea |
| SMILES | CCC(CC)N1C(=O)[C@@](C)(CC(=O)NNC(N)=O)CCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClN4O3/c1-4-15(5-2)25-16(13-6-8-14(21)9-7-13)10-11-20(3,18(25)27)12-17(26)23-24-19(22)28/h6-9,15-16H,4-5,10-12H2,1-3H3,(H,23,26)(H3,22,24,28)/t16?,20-/m1/s1 |
| InChIKey | QWZQBMNQFMHFKM-OTOKDRCRSA-N |
| XLogP | 3.29 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|