C24H34ClNOS — CID 130458497
(3R)-1-(2-tert-butylsulfanyl-1-cyclopropylethyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 130458497) has the molecular formula C24H34ClNOS and a molecular weight of 420.06 g/mol. Its IUPAC name is (3R)-1-(2-tert-butylsulfanyl-1-cyclopropylethyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R)-1-(2-tert-butylsulfanyl-1-cyclopropylethyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 130458497 |
| Molecular Formula | C24H34ClNOS |
| Molecular Weight | 420.06 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (3R)-1-(2-tert-butylsulfanyl-1-cyclopropylethyl)-6-(4-chlorophenyl)-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CCC(c2ccc(Cl)cc2)N(C(CSC(C)(C)C)C2CC2)C1=O |
| InChI | InChI=1S/C24H34ClNOS/c1-6-14-24(5)15-13-20(17-9-11-19(25)12-10-17)26(22(24)27)21(18-7-8-18)16-28-23(2,3)4/h6,9-12,18,20-21H,1,7-8,13-16H2,2-5H3/t20?,21?,24-/m0/s1 |
| InChIKey | VDAULEZHRGRRSH-VUNKPPBISA-N |
| XLogP | 6.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.06 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|