C21H28ClNO2 — CID 138641817
(3R)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-hydroxypropyl)-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 138641817) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is (3R)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-hydroxypropyl)-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-hydroxypropyl)-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 138641817 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (3R)-6-(4-chlorophenyl)-1-(1-cyclopropyl-2-hydroxypropyl)-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CCC(c2ccc(Cl)cc2)N(C(C(C)O)C2CC2)C1=O |
| InChI | InChI=1S/C21H28ClNO2/c1-4-12-21(3)13-11-18(15-7-9-17(22)10-8-15)23(20(21)25)19(14(2)24)16-5-6-16/h4,7-10,14,16,18-19,24H,1,5-6,11-13H2,2-3H3/t14?,18?,19?,21-/m0/s1 |
| InChIKey | UNCOYWWBSAKTEQ-CTRNPOFBSA-N |
| XLogP | 4.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|