C25H26Cl2INO2 — CID 70644558
(3R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-hydroxyethyl]-3-iodo-3-prop-2-enylpiperidin-2-one (PubChem CID 70644558) has the molecular formula C25H26Cl2INO2 and a molecular weight of 570.30 g/mol. Its IUPAC name is (3R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-hydroxyethyl]-3-iodo-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-hydroxyethyl]-3-iodo-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 70644558 |
| Molecular Formula | C25H26Cl2INO2 |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | (3R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-hydroxyethyl]-3-iodo-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(I)CC(c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](CO)C2CC2)C1=O |
| InChI | InChI=1S/C25H26Cl2INO2/c1-2-12-25(28)14-21(18-4-3-5-20(27)13-18)23(17-8-10-19(26)11-9-17)29(24(25)31)22(15-30)16-6-7-16/h2-5,8-11,13,16,21-23,30H,1,6-7,12,14-15H2/t21?,22-,23-,25-/m1/s1 |
| InChIKey | MYAIOQSWTOCRGI-LEDDBULKSA-N |
| XLogP | 6.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|