C28H33Cl2NO2 — CID 70644590
(3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[1-(oxolan-2-yl)propyl]-3-prop-2-enylpiperidin-2-one (PubChem CID 70644590) has the molecular formula C28H33Cl2NO2 and a molecular weight of 486.48 g/mol. Its IUPAC name is (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[1-(oxolan-2-yl)propyl]-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[1-(oxolan-2-yl)propyl]-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 70644590 |
| Molecular Formula | C28H33Cl2NO2 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (3S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-[1-(oxolan-2-yl)propyl]-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)C2CCCO2)C1=O |
| InChI | InChI=1S/C28H33Cl2NO2/c1-4-15-28(3)18-23(20-8-6-9-22(30)17-20)26(19-11-13-21(29)14-12-19)31(27(28)32)24(5-2)25-10-7-16-33-25/h4,6,8-9,11-14,17,23-26H,1,5,7,10,15-16,18H2,2-3H3/t23?,24?,25?,26?,28-/m0/s1 |
| InChIKey | VKHSMAHXISNUES-WAKJXLRYSA-N |
| XLogP | 7.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|