C21H19Cl2FO2 — CID 86731825
(3S,5R,6R)-6-(4-chloro-3-fluorophenyl)-5-(3-chlorophenyl)-3-methyl-3-prop-2-enyloxan-2-one (PubChem CID 86731825) has the molecular formula C21H19Cl2FO2 and a molecular weight of 393.29 g/mol. Its IUPAC name is (3S,5R,6R)-6-(4-chloro-3-fluorophenyl)-5-(3-chlorophenyl)-3-methyl-3-prop-2-enyloxan-2-one.
| Compound Name | (3S,5R,6R)-6-(4-chloro-3-fluorophenyl)-5-(3-chlorophenyl)-3-methyl-3-prop-2-enyloxan-2-one |
|---|---|
| PubChem CID | 86731825 |
| Molecular Formula | C21H19Cl2FO2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (3S,5R,6R)-6-(4-chloro-3-fluorophenyl)-5-(3-chlorophenyl)-3-methyl-3-prop-2-enyloxan-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)[C@H](c2ccc(Cl)c(F)c2)OC1=O |
| InChI | InChI=1S/C21H19Cl2FO2/c1-3-9-21(2)12-16(13-5-4-6-15(22)10-13)19(26-20(21)25)14-7-8-17(23)18(24)11-14/h3-8,10-11,16,19H,1,9,12H2,2H3/t16-,19+,21+/m1/s1 |
| InChIKey | BPXDGPCFMVWWSK-PBEJRMEISA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|