C14H20ClNO — CID 51349597
(2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholine (PubChem CID 51349597) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholine.
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholine |
|---|---|
| PubChem CID | 51349597 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-3,4,5,5-tetramethylmorpholine |
| SMILES | C[C@H]1[C@H](c2cccc(Cl)c2)OCC(C)(C)N1C |
| InChI | InChI=1S/C14H20ClNO/c1-10-13(11-6-5-7-12(15)8-11)17-9-14(2,3)16(10)4/h5-8,10,13H,9H2,1-4H3/t10-,13+/m0/s1 |
| InChIKey | VBTHYXSQNMPYRT-GXFFZTMASA-N |
| XLogP | 3.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |