C13H18N2O3 — CID 23660249
(2S,4R)-2-(4-nitrophenyl)-4-propan-2-yl-1,3-oxazinane (PubChem CID 23660249) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2S,4R)-2-(4-nitrophenyl)-4-propan-2-yl-1,3-oxazinane.
| Compound Name | (2S,4R)-2-(4-nitrophenyl)-4-propan-2-yl-1,3-oxazinane |
|---|---|
| PubChem CID | 23660249 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2S,4R)-2-(4-nitrophenyl)-4-propan-2-yl-1,3-oxazinane |
| SMILES | CC(C)[C@H]1CCO[C@@H](c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C13H18N2O3/c1-9(2)12-7-8-18-13(14-12)10-3-5-11(6-4-10)15(16)17/h3-6,9,12-14H,7-8H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | QWBDAFSFMLKXKQ-OLZOCXBDSA-N |
| XLogP | 2.63 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|