C14H19NO3 — CID 139990623
3,3-dimethyl-2-(4-nitrophenyl)-4-propan-2-yloxetane (PubChem CID 139990623) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3,3-dimethyl-2-(4-nitrophenyl)-4-propan-2-yloxetane.
| Compound Name | 3,3-dimethyl-2-(4-nitrophenyl)-4-propan-2-yloxetane |
|---|---|
| PubChem CID | 139990623 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3,3-dimethyl-2-(4-nitrophenyl)-4-propan-2-yloxetane |
| SMILES | CC(C)C1OC(c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C14H19NO3/c1-9(2)12-14(3,4)13(18-12)10-5-7-11(8-6-10)15(16)17/h5-9,12-13H,1-4H3 |
| InChIKey | BXJWJBIMGYSCCW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|