C27H36N2O6Si — CID 101227102
[(2S,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tri(propan-2-yl)silane (PubChem CID 101227102) has the molecular formula C27H36N2O6Si and a molecular weight of 512.68 g/mol. Its IUPAC name is [(2S,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tri(propan-2-yl)silane.
| Compound Name | [(2S,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101227102 |
| Molecular Formula | C27H36N2O6Si |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(2S,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C12C[C@@H](c3ccc([N+](=O)[O-])cc3)OC1O[C@@H](c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C27H36N2O6Si/c1-17(2)36(18(3)4,19(5)6)27-15-24(20-7-11-22(12-8-20)28(30)31)34-26(27)35-25(16-27)21-9-13-23(14-10-21)29(32)33/h7-14,17-19,24-26H,15-16H2,1-6H3/t24-,25+,26?,27? |
| InChIKey | NFLGXZFVRQZGFB-HTTSFZEZSA-N |
| XLogP | 7.87 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|