C34H34N2O6Si — CID 11753648
[(2R,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tert-butyl-diphenylsilane (PubChem CID 11753648) has the molecular formula C34H34N2O6Si and a molecular weight of 594.74 g/mol. Its IUPAC name is [(2R,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tert-butyl-diphenylsilane.
| Compound Name | [(2R,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11753648 |
| Molecular Formula | C34H34N2O6Si |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [(2R,5R)-2,5-bis(4-nitrophenyl)-3,4,5,6a-tetrahydro-2H-furo[2,3-b]furan-3a-yl]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C12C[C@H](c3ccc([N+](=O)[O-])cc3)OC1O[C@@H](c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C34H34N2O6Si/c1-33(2,3)43(28-10-6-4-7-11-28,29-12-8-5-9-13-29)34-22-30(24-14-18-26(19-15-24)35(37)38)41-32(34)42-31(23-34)25-16-20-27(21-17-25)36(39)40/h4-21,30-32H,22-23H2,1-3H3/t30-,31-,32?,34?/m1/s1 |
| InChIKey | OEIXZPKCENQUKG-XTBQKBRFSA-N |
| XLogP | 7.26 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|