C17H27NO6Si — CID 100995947
(3R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(4-nitrophenyl)oxane-2,3-diol (PubChem CID 100995947) has the molecular formula C17H27NO6Si and a molecular weight of 369.49 g/mol. Its IUPAC name is (3R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(4-nitrophenyl)oxane-2,3-diol.
| Compound Name | (3R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(4-nitrophenyl)oxane-2,3-diol |
|---|---|
| PubChem CID | 100995947 |
| Molecular Formula | C17H27NO6Si |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(4-nitrophenyl)oxane-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](c2ccc([N+](=O)[O-])cc2)OC(O)[C@@H]1O |
| InChI | InChI=1S/C17H27NO6Si/c1-17(2,3)25(4,5)24-14-10-13(23-16(20)15(14)19)11-6-8-12(9-7-11)18(21)22/h6-9,13-16,19-20H,10H2,1-5H3/t13-,14-,15+,16?/m0/s1 |
| InChIKey | IGKJWUAAUZLLRK-LSVZVQIISA-N |
| XLogP | 3.13 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|