C13H16N2O7S — CID 175955140
tert-butyl 5-(4-nitrophenyl)-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 175955140) has the molecular formula C13H16N2O7S and a molecular weight of 344.35 g/mol. Its IUPAC name is tert-butyl 5-(4-nitrophenyl)-2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-(4-nitrophenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 175955140 |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | tert-butyl 5-(4-nitrophenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc([N+](=O)[O-])cc2)OS1(=O)=O |
| InChI | InChI=1S/C13H16N2O7S/c1-13(2,3)21-12(16)14-8-11(22-23(14,19)20)9-4-6-10(7-5-9)15(17)18/h4-7,11H,8H2,1-3H3 |
| InChIKey | GTXBTKPKABBLPS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|