About tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate
tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 11195739) has the molecular formula C8H15NO5S
and a molecular weight of 237.28 g/mol. Its IUPAC name is tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate.
Analyze tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate?
The IUPAC name of tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CID 11195739) is tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate?
The canonical SMILES for tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate is C[C@H]1CN(C(=O)OC(C)(C)C)S(=O)(=O)O1.
What is the InChIKey of tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate?
The InChIKey is ZGFOJWQAHCHOLG-LURJTMIESA-N. The full InChI is InChI=1S/C8H15NO5S/c1-6-5-9(15(11,12)14-6)7(10)13-8(2,3)4/h6H,5H2,1-4H3/t6-/m0/s1.
What are the key properties of tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate?
tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate has a molecular weight of 237.28 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate is sourced from PubChem (CID 11195739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).