C11H19NO4S — CID 66592416
tert-butyl (3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxylate (PubChem CID 66592416) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 66592416 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | tert-butyl (3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C11H19NO4S/c1-11(2,3)16-10(13)12-4-8-6-17(14,15)7-9(8)5-12/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | JZSYCGHAJVNFSU-DTORHVGOSA-N |
| XLogP | 0.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |