C12H19NO6S — CID 165469445
5-[(2-methylpropan-2-yl)oxycarbonyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 165469445) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165469445 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC2CS(=O)(=O)C(C(=O)O)C2C1 |
| InChI | InChI=1S/C12H19NO6S/c1-12(2,3)19-11(16)13-4-7-6-20(17,18)9(10(14)15)8(7)5-13/h7-9H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | IGDFYFFMAMUACJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |