C12H18FNO3 — CID 167431590
tert-butyl (3aR,4R,6aS)-4-fluoro-5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 167431590) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6aS)-4-fluoro-5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6aS)-4-fluoro-5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 167431590 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | tert-butyl (3aR,4R,6aS)-4-fluoro-5-oxo-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(=O)[C@H](F)[C@H]2C1 |
| InChI | InChI=1S/C12H18FNO3/c1-12(2,3)17-11(16)14-5-7-4-9(15)10(13)8(7)6-14/h7-8,10H,4-6H2,1-3H3/t7-,8+,10-/m1/s1 |
| InChIKey | BWBWWYQFNPWREG-KHQFGBGNSA-N |
| XLogP | 1.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |