C12H19FN2O3 — CID 165340882
tert-butyl 7-fluoro-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate (PubChem CID 165340882) has the molecular formula C12H19FN2O3 and a molecular weight of 258.29 g/mol. Its IUPAC name is tert-butyl 7-fluoro-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 7-fluoro-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 165340882 |
| Molecular Formula | C12H19FN2O3 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | tert-butyl 7-fluoro-6-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CNC(=O)C(F)C2C1 |
| InChI | InChI=1S/C12H19FN2O3/c1-12(2,3)18-11(17)15-5-7-4-14-10(16)9(13)8(7)6-15/h7-9H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | GAEBIRDUSAWBRE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |