C11H20N2O4 — CID 177184014
tert-butyl (2R,6R)-2-carbamoyl-6-methylmorpholine-4-carboxylate (PubChem CID 177184014) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl (2R,6R)-2-carbamoyl-6-methylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,6R)-2-carbamoyl-6-methylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 177184014 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | tert-butyl (2R,6R)-2-carbamoyl-6-methylmorpholine-4-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H](C(N)=O)O1 |
| InChI | InChI=1S/C11H20N2O4/c1-7-5-13(6-8(16-7)9(12)14)10(15)17-11(2,3)4/h7-8H,5-6H2,1-4H3,(H2,12,14)/t7-,8-/m1/s1 |
| InChIKey | HGRCKEIBOYKMNA-HTQZYQBOSA-N |
| XLogP | 0.50 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |