C18H17NO4 — CID 24987776
1-[(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]ethanone (PubChem CID 24987776) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-[(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]ethanone.
| Compound Name | 1-[(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 24987776 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-[(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@@H](c2ccccc2)O[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17NO4/c1-12(20)16-11-17(13-5-3-2-4-6-13)23-18(16)14-7-9-15(10-8-14)19(21)22/h2-10,16-18H,11H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | KTSZSLOIJINMSE-SQNIBIBYSA-N |
| XLogP | 4.00 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|