C23H19NO4 — CID 24987775
[(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]-phenylmethanone (PubChem CID 24987775) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 24987775 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [(2R,3S,5S)-2-(4-nitrophenyl)-5-phenyloxolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1C[C@@H](c2ccccc2)O[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19NO4/c25-22(17-9-5-2-6-10-17)20-15-21(16-7-3-1-4-8-16)28-23(20)18-11-13-19(14-12-18)24(26)27/h1-14,20-21,23H,15H2/t20-,21+,23+/m1/s1 |
| InChIKey | UKYITHNIYKCLCV-GIWBLDEGSA-N |
| XLogP | 5.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|