C24H37NO9Si — CID 11027639
[(3aS,4R,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] 4-nitrobenzoate (PubChem CID 11027639) has the molecular formula C24H37NO9Si and a molecular weight of 511.64 g/mol. Its IUPAC name is [(3aS,4R,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] 4-nitrobenzoate.
| Compound Name | [(3aS,4R,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11027639 |
| Molecular Formula | C24H37NO9Si |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | [(3aS,4R,5S,7S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] 4-nitrobenzoate |
| SMILES | COCO[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C24H37NO9Si/c1-23(2,3)35(7,8)34-18-13-17(30-14-29-6)20-21(33-24(4,5)32-20)19(18)31-22(26)15-9-11-16(12-10-15)25(27)28/h9-12,17-21H,13-14H2,1-8H3/t17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | CCVBXICQHSYKLA-UQVNRYHBSA-N |
| XLogP | 4.42 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|