C32H46Br2O6Si2 — CID 139115330
[(1R,2R,4R,5R)-5-(4-bromobenzoyl)oxy-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl] 4-bromobenzoate (PubChem CID 139115330) has the molecular formula C32H46Br2O6Si2 and a molecular weight of 742.69 g/mol. Its IUPAC name is [(1R,2R,4R,5R)-5-(4-bromobenzoyl)oxy-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl] 4-bromobenzoate.
| Compound Name | [(1R,2R,4R,5R)-5-(4-bromobenzoyl)oxy-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 139115330 |
| Molecular Formula | C32H46Br2O6Si2 |
| Molecular Weight | 742.69 g/mol |
| Exact Mass | 740.12 |
| IUPAC Name | [(1R,2R,4R,5R)-5-(4-bromobenzoyl)oxy-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexyl] 4-bromobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)c2ccc(Br)cc2)C[C@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H46Br2O6Si2/c1-31(2,3)41(7,8)39-27-20-28(40-42(9,10)32(4,5)6)26(38-30(36)22-13-17-24(34)18-14-22)19-25(27)37-29(35)21-11-15-23(33)16-12-21/h11-18,25-28H,19-20H2,1-10H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | FLTCQPVHFHFSCN-BIYDSLDMSA-N |
| XLogP | 9.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.69 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|