C24H32ClNO3Si — CID 23241927
[(1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(6-chloro-3-pyridinyl)cyclohexyl] benzoate (PubChem CID 23241927) has the molecular formula C24H32ClNO3Si and a molecular weight of 446.06 g/mol. Its IUPAC name is [(1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(6-chloro-3-pyridinyl)cyclohexyl] benzoate.
| Compound Name | [(1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(6-chloro-3-pyridinyl)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 23241927 |
| Molecular Formula | C24H32ClNO3Si |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [(1S,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(6-chloro-3-pyridinyl)cyclohexyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H](OC(=O)c2ccccc2)[C@@H](c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C24H32ClNO3Si/c1-24(2,3)30(4,5)29-19-12-13-21(28-23(27)17-9-7-6-8-10-17)20(15-19)18-11-14-22(25)26-16-18/h6-11,14,16,19-21H,12-13,15H2,1-5H3/t19-,20+,21-/m0/s1 |
| InChIKey | YJBAJJKFZYNMCG-HBMCJLEFSA-N |
| XLogP | 6.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|