C27H36O7Si — CID 67152952
[(2R,3R,4R,5R)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyloxan-3-yl] benzoate (PubChem CID 67152952) has the molecular formula C27H36O7Si and a molecular weight of 500.66 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 67152952 |
| Molecular Formula | C27H36O7Si |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [(2R,3R,4R,5R)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyloxan-3-yl] benzoate |
| SMILES | COC1O[C@H](C)[C@@H](OC(=O)c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H36O7Si/c1-18-21(32-24(28)19-14-10-8-11-15-19)22(34-35(6,7)27(2,3)4)23(26(30-5)31-18)33-25(29)20-16-12-9-13-17-20/h8-18,21-23,26H,1-7H3/t18-,21-,22-,23-,26?/m1/s1 |
| InChIKey | JAAGMQOWADOVNK-BLHXIIGOSA-N |
| XLogP | 5.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|