C20H31IO5Si — CID 11214317
[(2R,3R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-6-methoxy-2-methyloxan-3-yl] benzoate (PubChem CID 11214317) has the molecular formula C20H31IO5Si and a molecular weight of 506.45 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-6-methoxy-2-methyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-6-methoxy-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11214317 |
| Molecular Formula | C20H31IO5Si |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-6-methoxy-2-methyloxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](OC(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1I |
| InChI | InChI=1S/C20H31IO5Si/c1-13-16(25-18(22)14-11-9-8-10-12-14)17(15(21)19(23-5)24-13)26-27(6,7)20(2,3)4/h8-13,15-17,19H,1-7H3/t13-,15+,16-,17-,19+/m1/s1 |
| InChIKey | VMTJCVAQPOLKLH-CFLZNVQHSA-N |
| XLogP | 4.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|