C15H29IO5Si — CID 24788005
[(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4-methoxy-6-methyloxan-2-yl] acetate (PubChem CID 24788005) has the molecular formula C15H29IO5Si and a molecular weight of 444.38 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4-methoxy-6-methyloxan-2-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4-methoxy-6-methyloxan-2-yl] acetate |
|---|---|
| PubChem CID | 24788005 |
| Molecular Formula | C15H29IO5Si |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-4-methoxy-6-methyloxan-2-yl] acetate |
| SMILES | CO[C@@H]1[C@@H](I)[C@H](OC(C)=O)O[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IO5Si/c1-9-12(21-22(7,8)15(3,4)5)13(18-6)11(16)14(19-9)20-10(2)17/h9,11-14H,1-8H3/t9-,11-,12-,13-,14+/m1/s1 |
| InChIKey | PJQGETCNKSFYSZ-FZGMBXNASA-N |
| XLogP | 3.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|