C15H32O5Si — CID 59441458
tert-butyl-dimethyl-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxysilane (PubChem CID 59441458) has the molecular formula C15H32O5Si and a molecular weight of 320.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxysilane |
|---|---|
| PubChem CID | 59441458 |
| Molecular Formula | C15H32O5Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxysilane |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C15H32O5Si/c1-10-11(16-5)12(17-6)13(18-7)14(19-10)20-21(8,9)15(2,3)4/h10-14H,1-9H3/t10-,11-,12+,13+,14-/m0/s1 |
| InChIKey | BODWHYULNQYCHM-QNSTZXKLSA-N |
| XLogP | 2.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|