C15H32O5Si — CID 68765012
butyl-dimethyl-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxysilane (PubChem CID 68765012) has the molecular formula C15H32O5Si and a molecular weight of 320.50 g/mol. Its IUPAC name is butyl-dimethyl-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxysilane.
| Compound Name | butyl-dimethyl-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxysilane |
|---|---|
| PubChem CID | 68765012 |
| Molecular Formula | C15H32O5Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | butyl-dimethyl-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxysilane |
| SMILES | CCCC[Si](C)(C)OC1OC(C)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C15H32O5Si/c1-8-9-10-21(6,7)20-15-14(18-5)13(17-4)12(16-3)11(2)19-15/h11-15H,8-10H2,1-7H3 |
| InChIKey | WGENCQIERWWNHA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|