C14H27NO6 — CID 166897437
[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-butan-2-ylcarbamate (PubChem CID 166897437) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-butan-2-ylcarbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-butan-2-ylcarbamate |
|---|---|
| PubChem CID | 166897437 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-butan-2-ylcarbamate |
| SMILES | CCC(C)NC(=O)O[C@@H]1O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C14H27NO6/c1-7-8(2)15-14(16)21-13-12(19-6)11(18-5)10(17-4)9(3)20-13/h8-13H,7H2,1-6H3,(H,15,16)/t8?,9-,10-,11+,12+,13-/m0/s1 |
| InChIKey | CVYRLVFUZWAEBB-ZTRLVFFBSA-N |
| XLogP | 1.30 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |