About sulfanyl N-butan-2-ylcarbamate
sulfanyl N-butan-2-ylcarbamate (PubChem CID 58226162) has the molecular formula C5H11NO2S
and a molecular weight of 149.22 g/mol. Its IUPAC name is sulfanyl N-butan-2-ylcarbamate.
Molecular Properties
| Compound Name | sulfanyl N-butan-2-ylcarbamate |
| PubChem CID | 58226162 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | sulfanyl N-butan-2-ylcarbamate |
| SMILES | CCC(C)NC(=O)OS |
| InChI | InChI=1S/C5H11NO2S/c1-3-4(2)6-5(7)8-9/h4,9H,3H2,1-2H3,(H,6,7) |
| InChIKey | VUHVBPRXIUPUIU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl N-butan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl N-butan-2-ylcarbamate?
The IUPAC name of sulfanyl N-butan-2-ylcarbamate (CID 58226162) is sulfanyl N-butan-2-ylcarbamate.
What is the SMILES notation for sulfanyl N-butan-2-ylcarbamate?
The canonical SMILES for sulfanyl N-butan-2-ylcarbamate is CCC(C)NC(=O)OS.
What is the InChIKey of sulfanyl N-butan-2-ylcarbamate?
The InChIKey is VUHVBPRXIUPUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S/c1-3-4(2)6-5(7)8-9/h4,9H,3H2,1-2H3,(H,6,7).
What are the key properties of sulfanyl N-butan-2-ylcarbamate?
sulfanyl N-butan-2-ylcarbamate has a molecular weight of 149.22 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl N-butan-2-ylcarbamate is sourced from PubChem (CID 58226162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).