About N-butan-2-ylcarbamoyl iodide
N-butan-2-ylcarbamoyl iodide (PubChem CID 118554163) has the molecular formula C5H10INO
and a molecular weight of 227.04 g/mol. Its IUPAC name is N-butan-2-ylcarbamoyl iodide.
Molecular Properties
| Compound Name | N-butan-2-ylcarbamoyl iodide |
| PubChem CID | 118554163 |
| Molecular Formula | C5H10INO |
| Molecular Weight | 227.04 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | N-butan-2-ylcarbamoyl iodide |
| SMILES | CCC(C)NC(=O)I |
| InChI | InChI=1S/C5H10INO/c1-3-4(2)7-5(6)8/h4H,3H2,1-2H3,(H,7,8) |
| InChIKey | XTYHEFROSSIBMK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.04 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylcarbamoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylcarbamoyl iodide?
The IUPAC name of N-butan-2-ylcarbamoyl iodide (CID 118554163) is N-butan-2-ylcarbamoyl iodide.
What is the SMILES notation for N-butan-2-ylcarbamoyl iodide?
The canonical SMILES for N-butan-2-ylcarbamoyl iodide is CCC(C)NC(=O)I.
What is the InChIKey of N-butan-2-ylcarbamoyl iodide?
The InChIKey is XTYHEFROSSIBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10INO/c1-3-4(2)7-5(6)8/h4H,3H2,1-2H3,(H,7,8).
What are the key properties of N-butan-2-ylcarbamoyl iodide?
N-butan-2-ylcarbamoyl iodide has a molecular weight of 227.04 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylcarbamoyl iodide is sourced from PubChem (CID 118554163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).