C6H12CaN2O2S2 — CID 118002354
calcium;N-butan-2-ylcarbamothioate;carbamothioate (PubChem CID 118002354) has the molecular formula C6H12CaN2O2S2 and a molecular weight of 248.39 g/mol. Its IUPAC name is calcium;N-butan-2-ylcarbamothioate;carbamothioate.
| Compound Name | calcium;N-butan-2-ylcarbamothioate;carbamothioate |
|---|---|
| PubChem CID | 118002354 |
| Molecular Formula | C6H12CaN2O2S2 |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | calcium;N-butan-2-ylcarbamothioate;carbamothioate |
| SMILES | CCC(C)NC(=O)[S-].NC(=O)[S-].[Ca+2] |
| InChI | InChI=1S/C5H11NOS.CH3NOS.Ca/c1-3-4(2)6-5(7)8;2-1(3)4;/h4H,3H2,1-2H3,(H2,6,7,8);(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | COVGHXKAKXSQPN-UHFFFAOYSA-L |
| XLogP | 0.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|