C7H15N3OS — CID 88816478
methyl N'-(butan-2-ylcarbamoyl)carbamimidothioate (PubChem CID 88816478) has the molecular formula C7H15N3OS and a molecular weight of 189.28 g/mol. Its IUPAC name is methyl N'-(butan-2-ylcarbamoyl)carbamimidothioate.
| Compound Name | methyl N'-(butan-2-ylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 88816478 |
| Molecular Formula | C7H15N3OS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | methyl N'-(butan-2-ylcarbamoyl)carbamimidothioate |
| SMILES | CCC(C)NC(=O)/N=C(\N)SC |
| InChI | InChI=1S/C7H15N3OS/c1-4-5(2)9-7(11)10-6(8)12-3/h5H,4H2,1-3H3,(H3,8,9,10,11) |
| InChIKey | SUQAIIBKWZMIRY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|