About calcium;N-propan-2-ylcarbamothioate;carbamothioate
calcium;N-propan-2-ylcarbamothioate;carbamothioate (PubChem CID 118002432) has the molecular formula C5H10CaN2O2S2
and a molecular weight of 234.36 g/mol. Its IUPAC name is calcium;N-propan-2-ylcarbamothioate;carbamothioate.
Molecular Properties
| Compound Name | calcium;N-propan-2-ylcarbamothioate;carbamothioate |
| PubChem CID | 118002432 |
| Molecular Formula | C5H10CaN2O2S2 |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | calcium;N-propan-2-ylcarbamothioate;carbamothioate |
| SMILES | CC(C)NC(=O)[S-].NC(=O)[S-].[Ca+2] |
| InChI | InChI=1S/C4H9NOS.CH3NOS.Ca/c1-3(2)5-4(6)7;2-1(3)4;/h3H,1-2H3,(H2,5,6,7);(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | STFOLYKGPBPFAS-UHFFFAOYSA-L |
| XLogP | -0.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;N-propan-2-ylcarbamothioate;carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;N-propan-2-ylcarbamothioate;carbamothioate?
The IUPAC name of calcium;N-propan-2-ylcarbamothioate;carbamothioate (CID 118002432) is calcium;N-propan-2-ylcarbamothioate;carbamothioate.
What is the SMILES notation for calcium;N-propan-2-ylcarbamothioate;carbamothioate?
The canonical SMILES for calcium;N-propan-2-ylcarbamothioate;carbamothioate is CC(C)NC(=O)[S-].NC(=O)[S-].[Ca+2].
What is the InChIKey of calcium;N-propan-2-ylcarbamothioate;carbamothioate?
The InChIKey is STFOLYKGPBPFAS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H9NOS.CH3NOS.Ca/c1-3(2)5-4(6)7;2-1(3)4;/h3H,1-2H3,(H2,5,6,7);(H3,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;N-propan-2-ylcarbamothioate;carbamothioate?
calcium;N-propan-2-ylcarbamothioate;carbamothioate has a molecular weight of 234.36 g/mol, XLogP of -0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;N-propan-2-ylcarbamothioate;carbamothioate is sourced from PubChem (CID 118002432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).