C4H12N4O — CID 174558732
1,1-diamino-3-propan-2-ylurea (PubChem CID 174558732) has the molecular formula C4H12N4O and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,1-diamino-3-propan-2-ylurea.
| Compound Name | 1,1-diamino-3-propan-2-ylurea |
|---|---|
| PubChem CID | 174558732 |
| Molecular Formula | C4H12N4O |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 1,1-diamino-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(N)N |
| InChI | InChI=1S/C4H12N4O/c1-3(2)7-4(9)8(5)6/h3H,5-6H2,1-2H3,(H,7,9) |
| InChIKey | GJSHAGVJMUQDGO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|