C22H24N2O — CID 70614789
benzene;1,1-diphenyl-3-propan-2-ylurea (PubChem CID 70614789) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is benzene;1,1-diphenyl-3-propan-2-ylurea.
| Compound Name | benzene;1,1-diphenyl-3-propan-2-ylurea |
|---|---|
| PubChem CID | 70614789 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | benzene;1,1-diphenyl-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(c1ccccc1)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C16H18N2O.C6H6/c1-13(2)17-16(19)18(14-9-5-3-6-10-14)15-11-7-4-8-12-15;1-2-4-6-5-3-1/h3-13H,1-2H3,(H,17,19);1-6H |
| InChIKey | QHOCVUAPGWICLH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |