C15H22N2O2 — CID 71028151
N'-phenyl-N,N'-di(propan-2-yl)propanediamide (PubChem CID 71028151) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-phenyl-N,N'-di(propan-2-yl)propanediamide.
| Compound Name | N'-phenyl-N,N'-di(propan-2-yl)propanediamide |
|---|---|
| PubChem CID | 71028151 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-phenyl-N,N'-di(propan-2-yl)propanediamide |
| SMILES | CC(C)NC(=O)CC(=O)N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-11(2)16-14(18)10-15(19)17(12(3)4)13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3,(H,16,18) |
| InChIKey | RFZBRTMSXZEQAD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|