About N'-(1-chloroethyl)oxamide
N'-(1-chloroethyl)oxamide (PubChem CID 175433952) has the molecular formula C4H7ClN2O2
and a molecular weight of 150.56 g/mol. Its IUPAC name is N'-(1-chloroethyl)oxamide.
Molecular Properties
| Compound Name | N'-(1-chloroethyl)oxamide |
| PubChem CID | 175433952 |
| Molecular Formula | C4H7ClN2O2 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | N'-(1-chloroethyl)oxamide |
| SMILES | CC(Cl)NC(=O)C(N)=O |
| InChI | InChI=1S/C4H7ClN2O2/c1-2(5)7-4(9)3(6)8/h2H,1H3,(H2,6,8)(H,7,9) |
| InChIKey | JQIJDYHZUKDPFX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-chloroethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-chloroethyl)oxamide?
The IUPAC name of N'-(1-chloroethyl)oxamide (CID 175433952) is N'-(1-chloroethyl)oxamide.
What is the SMILES notation for N'-(1-chloroethyl)oxamide?
The canonical SMILES for N'-(1-chloroethyl)oxamide is CC(Cl)NC(=O)C(N)=O.
What is the InChIKey of N'-(1-chloroethyl)oxamide?
The InChIKey is JQIJDYHZUKDPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClN2O2/c1-2(5)7-4(9)3(6)8/h2H,1H3,(H2,6,8)(H,7,9).
What are the key properties of N'-(1-chloroethyl)oxamide?
N'-(1-chloroethyl)oxamide has a molecular weight of 150.56 g/mol, XLogP of -0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-chloroethyl)oxamide is sourced from PubChem (CID 175433952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).