About dichloromethylurea
dichloromethylurea (PubChem CID 23083847) has the molecular formula C2H4Cl2N2O
and a molecular weight of 142.97 g/mol. Its IUPAC name is dichloromethylurea.
Molecular Properties
| Compound Name | dichloromethylurea |
| PubChem CID | 23083847 |
| Molecular Formula | C2H4Cl2N2O |
| Molecular Weight | 142.97 g/mol |
| Exact Mass | 141.97 |
| IUPAC Name | dichloromethylurea |
| SMILES | NC(=O)NC(Cl)Cl |
| InChI | InChI=1S/C2H4Cl2N2O/c3-1(4)6-2(5)7/h1H,(H3,5,6,7) |
| InChIKey | QEMZNSKDTGKKFO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.97 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze dichloromethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethylurea?
The IUPAC name of dichloromethylurea (CID 23083847) is dichloromethylurea.
What is the SMILES notation for dichloromethylurea?
The canonical SMILES for dichloromethylurea is NC(=O)NC(Cl)Cl.
What is the InChIKey of dichloromethylurea?
The InChIKey is QEMZNSKDTGKKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2N2O/c3-1(4)6-2(5)7/h1H,(H3,5,6,7).
What are the key properties of dichloromethylurea?
dichloromethylurea has a molecular weight of 142.97 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethylurea is sourced from PubChem (CID 23083847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).