About [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea
[(4R,5S)-5-(carbamoylamino)octan-4-yl]urea (PubChem CID 92527887) has the molecular formula C10H22N4O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea.
Molecular Properties
| Compound Name | [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea |
| PubChem CID | 92527887 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea |
| SMILES | CCC[C@H](NC(N)=O)[C@@H](CCC)NC(N)=O |
| InChI | InChI=1S/C10H22N4O2/c1-3-5-7(13-9(11)15)8(6-4-2)14-10(12)16/h7-8H,3-6H2,1-2H3,(H3,11,13,15)(H3,12,14,16)/t7-,8+ |
| InChIKey | COWRUZRIWKCLGP-OCAPTIKFSA-N |
| XLogP | 0.66 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea?
The IUPAC name of [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea (CID 92527887) is [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea.
What is the SMILES notation for [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea?
The canonical SMILES for [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea is CCC[C@H](NC(N)=O)[C@@H](CCC)NC(N)=O.
What is the InChIKey of [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea?
The InChIKey is COWRUZRIWKCLGP-OCAPTIKFSA-N. The full InChI is InChI=1S/C10H22N4O2/c1-3-5-7(13-9(11)15)8(6-4-2)14-10(12)16/h7-8H,3-6H2,1-2H3,(H3,11,13,15)(H3,12,14,16)/t7-,8+.
What are the key properties of [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea?
[(4R,5S)-5-(carbamoylamino)octan-4-yl]urea has a molecular weight of 230.31 g/mol, XLogP of 0.66, 7 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea is sourced from PubChem (CID 92527887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).