C10H22N4O2 — CID 92527887
[(4R,5S)-5-(carbamoylamino)octan-4-yl]urea (PubChem CID 92527887) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea.
| Compound Name | [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea |
|---|---|
| PubChem CID | 92527887 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(4R,5S)-5-(carbamoylamino)octan-4-yl]urea |
| SMILES | CCC[C@H](NC(N)=O)[C@@H](CCC)NC(N)=O |
| InChI | InChI=1S/C10H22N4O2/c1-3-5-7(13-9(11)15)8(6-4-2)14-10(12)16/h7-8H,3-6H2,1-2H3,(H3,11,13,15)(H3,12,14,16)/t7-,8+ |
| InChIKey | COWRUZRIWKCLGP-OCAPTIKFSA-N |
| XLogP | 0.66 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |