About 1-diethoxysilylbutylurea
1-diethoxysilylbutylurea (PubChem CID 173025358) has the molecular formula C9H22N2O3Si
and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-diethoxysilylbutylurea.
Molecular Properties
| Compound Name | 1-diethoxysilylbutylurea |
| PubChem CID | 173025358 |
| Molecular Formula | C9H22N2O3Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-diethoxysilylbutylurea |
| SMILES | CCCC(NC(N)=O)[SiH](OCC)OCC |
| InChI | InChI=1S/C9H22N2O3Si/c1-4-7-8(11-9(10)12)15(13-5-2)14-6-3/h8,15H,4-7H2,1-3H3,(H3,10,11,12) |
| InChIKey | IEDDRLUQKWOIBI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxysilylbutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxysilylbutylurea?
The IUPAC name of 1-diethoxysilylbutylurea (CID 173025358) is 1-diethoxysilylbutylurea.
What is the SMILES notation for 1-diethoxysilylbutylurea?
The canonical SMILES for 1-diethoxysilylbutylurea is CCCC(NC(N)=O)[SiH](OCC)OCC.
What is the InChIKey of 1-diethoxysilylbutylurea?
The InChIKey is IEDDRLUQKWOIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O3Si/c1-4-7-8(11-9(10)12)15(13-5-2)14-6-3/h8,15H,4-7H2,1-3H3,(H3,10,11,12).
What are the key properties of 1-diethoxysilylbutylurea?
1-diethoxysilylbutylurea has a molecular weight of 234.37 g/mol, XLogP of 0.66, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxysilylbutylurea is sourced from PubChem (CID 173025358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).