About hexan-3-ylurea;molecular hydrogen
hexan-3-ylurea;molecular hydrogen (PubChem CID 143768672) has the molecular formula C7H20N2O
and a molecular weight of 148.25 g/mol. Its IUPAC name is hexan-3-ylurea;molecular hydrogen.
Molecular Properties
| Compound Name | hexan-3-ylurea;molecular hydrogen |
| PubChem CID | 143768672 |
| Molecular Formula | C7H20N2O |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.16 |
| IUPAC Name | hexan-3-ylurea;molecular hydrogen |
| SMILES | CCCC(CC)NC(N)=O.[H][H].[H][H] |
| InChI | InChI=1S/C7H16N2O.2H2/c1-3-5-6(4-2)9-7(8)10;;/h6H,3-5H2,1-2H3,(H3,8,9,10);2*1H |
| InChIKey | DHBNGRKEEMUDKR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hexan-3-ylurea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-ylurea;molecular hydrogen?
The IUPAC name of hexan-3-ylurea;molecular hydrogen (CID 143768672) is hexan-3-ylurea;molecular hydrogen.
What is the SMILES notation for hexan-3-ylurea;molecular hydrogen?
The canonical SMILES for hexan-3-ylurea;molecular hydrogen is CCCC(CC)NC(N)=O.[H][H].[H][H].
What is the InChIKey of hexan-3-ylurea;molecular hydrogen?
The InChIKey is DHBNGRKEEMUDKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.2H2/c1-3-5-6(4-2)9-7(8)10;;/h6H,3-5H2,1-2H3,(H3,8,9,10);2*1H.
What are the key properties of hexan-3-ylurea;molecular hydrogen?
hexan-3-ylurea;molecular hydrogen has a molecular weight of 148.25 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-ylurea;molecular hydrogen is sourced from PubChem (CID 143768672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).