C10H22N6O3 — CID 154207016
5,7-bis(carbamoylamino)heptan-3-ylurea (PubChem CID 154207016) has the molecular formula C10H22N6O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5,7-bis(carbamoylamino)heptan-3-ylurea.
| Compound Name | 5,7-bis(carbamoylamino)heptan-3-ylurea |
|---|---|
| PubChem CID | 154207016 |
| Molecular Formula | C10H22N6O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 5,7-bis(carbamoylamino)heptan-3-ylurea |
| SMILES | CCC(CC(CCNC(N)=O)NC(N)=O)NC(N)=O |
| InChI | InChI=1S/C10H22N6O3/c1-2-6(15-9(12)18)5-7(16-10(13)19)3-4-14-8(11)17/h6-7H,2-5H2,1H3,(H3,11,14,17)(H3,12,15,18)(H3,13,16,19) |
| InChIKey | SQWSVVQIUYNOSU-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |